CAS 96158-13-3
:β-D-Glucopyranosiduronic acid, (3β)-17-carboxy-28-norolean-12-en-3-yl O-α-L-arabinopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-
Description:
β-D-Glucopyranosiduronic acid, with the CAS number 96158-13-3, is a complex glycoside characterized by its unique structural features, including a glucopyranosiduronic acid moiety and a triterpenoid backbone derived from oleanolic acid. This compound exhibits a combination of hydrophilic and hydrophobic properties due to the presence of sugar units and a steroid-like structure, which can influence its solubility and biological activity. The glycosidic linkages, specifically the α-L-arabinopyranosyl and β-D-xylopyranosyl units, contribute to its potential interactions with biological systems, including enzyme inhibition or modulation of cell signaling pathways. Additionally, the carboxylic acid functional group enhances its reactivity and potential for forming salts or esters. Such compounds are often studied for their pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. Overall, the structural complexity and functional groups present in β-D-Glucopyranosiduronic acid suggest a diverse range of potential applications in medicinal chemistry and biochemistry.
Formula:C46H72O17
InChI:InChI=1S/C46H72O17/c1-41(2)14-16-46(40(56)57)17-15-44(6)21(22(46)18-41)8-9-26-43(5)12-11-27(42(3,4)25(43)10-13-45(26,44)7)60-39-35(63-38-31(52)29(50)24(48)20-59-38)33(32(53)34(62-39)36(54)55)61-37-30(51)28(49)23(47)19-58-37/h8,22-35,37-39,47-53H,9-20H2,1-7H3,(H,54,55)(H,56,57)
InChI key:InChIKey=XQGKHFSVPNPHAB-UHFFFAOYSA-N
SMILES:CC12C3(C)C(C4C(C(O)=O)(CC3)CCC(C)(C)C4)=CCC1C5(C)C(CC2)C(C)(C)C(OC6C(OC7C(O)C(O)C(O)CO7)C(OC8C(O)C(O)C(O)CO8)C(O)C(C(O)=O)O6)CC5
Synonyms:- β-D-Glucopyranosiduronic acid, (3β)-17-carboxy-28-norolean-12-en-3-yl O-α-L-arabinopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-
- Momordin Ie
- 28-Noroleanane, β-D-glucopyranosiduronic acid deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Momordin 1e
CAS:Momordin 1e is a triterpenoid saponin, which is an active biological compound, derived from the plant species Momordica charantia, commonly known as bitter melon. This compound is sourced primarily from the seeds and fruit of the plant and is known for its diverse biochemical activities. The mode of action of Momordin 1e involves the inhibition of viral replication, making it a subject of interest in antiviral research. It is hypothesized to disrupt viral RNA synthesis, which prevents the proliferation of the virus within host cells.Formula:C46H72O17Purity:Min. 95%Molecular weight:897.05 g/mol


