CymitQuimica logo

CAS 96166-00-6

:

5-(benzyloxy)pyridin-2-amine

Description:
5-(Benzyloxy)pyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a benzyloxy group attached to the 5-position of the pyridine ring and an amino group at the 2-position. This structure imparts both basic and nucleophilic properties to the molecule, making it potentially useful in various chemical reactions and applications, including medicinal chemistry and organic synthesis. The presence of the benzyloxy group enhances the lipophilicity of the compound, which may influence its biological activity and solubility in organic solvents. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's interactions in biological systems. The compound's molecular structure allows for potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Overall, 5-(benzyloxy)pyridin-2-amine is a versatile compound with interesting chemical properties that warrant further investigation in various fields of chemistry.
Formula:C12H12N2O
InChI:InChI=1/C12H12N2O/c13-12-7-6-11(8-14-12)15-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,13,14)
InChI key:KMWUTRXLBBOIJE-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1ccc(=N)[nH]c1
Synonyms:
  • 2-Pyridinamine, 5-(Phenylmethoxy)-
  • 5-(Benzyloxy)pyridin-2-amine
  • 5-Benzyloxypyridin-2-ylamine
  • 5-(Phenylmethoxy)-2-pyridinamine
  • 2-Amino-5-(benzyloxy)pyridine
Found 4 products.