CAS 96180-79-9
:(5R,8S,11R,12S,15S,18S,19S,22R)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,15,19-pentamethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid
Description:
The chemical substance with the name "(5R,8S,11R,12S,15S,18S,19S,22R)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,15,19-pentamethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid" and CAS number "96180-79-9" is a complex organic compound characterized by its intricate multi-ring structure and multiple functional groups. It features a heptaazacyclopentacosane backbone, indicating the presence of seven nitrogen atoms within its cyclic structure, which contributes to its potential biological activity. The compound also contains several ketone and carboxylic acid functional groups, suggesting it may exhibit significant reactivity and solubility properties. The presence of multiple methyl and phenyl substituents indicates potential for hydrophobic interactions, which could influence its behavior in biological systems. Additionally, the stereochemistry denoted by the R and S configurations suggests that the compound may have specific spatial orientations that could affect its interaction with biological targets, making it of interest in medicinal chemistry and pharmacology.
Formula:C46H67N7O12
InChI:InChI=1/C46H67N7O12/c1-24(2)21-35-44(60)52-38(46(63)64)28(6)40(56)47-29(7)41(57)49-33(18-17-25(3)22-26(4)36(65-11)23-32-15-13-12-14-16-32)27(5)39(55)50-34(45(61)62)19-20-37(54)53(10)31(9)43(59)48-30(8)42(58)51-35/h12-18,22,24,26-30,33-36,38H,9,19-21,23H2,1-8,10-11H3,(H,47,56)(H,48,59)(H,49,57)(H,50,55)(H,51,58)(H,52,60)(H,61,62)(H,63,64)/b18-17+,25-22+/t26-,27-,28-,29-,30+,33-,34+,35-,36-,38+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Microcystin LA from algae
CAS:Controlled ProductMicrocystin LA is a cyclic peptide that is extracted from the algae Microcystis aeruginosa. It has been found to have a broad spectrum of activity against bacterial and fungal strains in vitro, as well as against some animal cells. Microcystin LA binds to the receptor on the mitochondrial membrane, which causes depolarization, leading to inhibition of energy production and cell death. Microcystin LA also has high affinity for monoclonal antibodies and can be used in immunoassays to detect bacterial or fungal cells. This compound can be used for sample preparation in analytical chemistry because it inhibits the polymerase chain reaction (PCR). Furthermore, this compound can be used for natural products research due to its ability to inhibit protein synthesis.Formula:C46H67N7O12Purity:Min. 95%Molecular weight:910.06 g/molRef: 4Z-M-198001
Discontinued product

