CAS 96193-26-9

(8aR)-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

Description:

(8aR)-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione, with the CAS number 96193-26-9, is a bicyclic organic compound characterized by its unique fused ring structure, which includes a pyrazine moiety. This compound features a hexahydropyrrolo framework, indicating that it contains a saturated nitrogen-containing ring system. The presence of the 1,4-dione functional groups suggests that it has two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The stereochemistry, denoted by the (8aR) configuration, indicates a specific spatial arrangement of atoms that can influence the compound's reactivity and interactions with biological systems. Generally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, their structural features can lead to diverse applications in organic synthesis and material science. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)/t5-/m1/s1

SMILES: C1C[C@@H]2C(=NCC(=O)N2C1)O

Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-, (R)-

CAS: 96193-26-9

Formula: C₇H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.1665

Ref: IN-DA00IJSD

(R)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione

CAS: 96193-26-9

Purity: 95.0%

Molecular weight: 154.16900634765625

Ref: 10-F335122