CymitQuimica logo

CAS 962-95-8

:

3-(diphenylphosphoryl)-N,N-dimethylpropan-1-amine

Description:
3-(Diphenylphosphoryl)-N,N-dimethylpropan-1-amine, with CAS number 962-95-8, is an organic compound characterized by its unique structure that includes a diphenylphosphoryl group attached to a dimethylamino propanamine backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its role as a reagent in organic synthesis, particularly in the formation of phosphoramides and other phosphorus-containing compounds. The presence of the diphenylphosphoryl moiety imparts significant reactivity, making it useful in various chemical transformations. Additionally, the dimethylamino group contributes to its basicity and potential interactions with other chemical species. Due to its phosphorus content, this compound may exhibit specific properties such as coordination with metal ions and participation in catalytic processes. Safety data should be consulted, as it may pose health hazards if not handled properly, including potential toxicity and environmental impact.
Formula:C17H22NOP
InChI:InChI=1/C17H22NOP/c1-18(2)14-9-15-20(19,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13H,9,14-15H2,1-2H3
SMILES:CN(C)CCCP(=O)(c1ccccc1)c1ccccc1
Synonyms:
  • N,N-Dimethyl-3-(diphenylphosphinyl)-1-propylamine
  • Olopatadine Impurity 23
  • Olopatadine Impurity 22
  • 1-Propanamine, 3-(diphenylphosphinyl)-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.