CAS 96201-52-4
:2-(biphenyl-4-yl)-5-chloro-3-methylquinoline-4-carboxylic acid
Description:
2-(Biphenyl-4-yl)-5-chloro-3-methylquinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a biphenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for π-π stacking interactions due to its extended conjugated system. The presence of the chlorine atom introduces additional reactivity and can influence the compound's solubility and biological activity. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters. The compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active molecules, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and may vary based on the conditions of synthesis and purification.
Formula:C23H16ClNO2
InChI:InChI=1/C23H16ClNO2/c1-14-20(23(26)27)21-18(24)8-5-9-19(21)25-22(14)17-12-10-16(11-13-17)15-6-3-2-4-7-15/h2-13H,1H3,(H,26,27)
Synonyms:- 4-quinolinecarboxylic acid, 2-[1,1'-biphenyl]-4-yl-5-chloro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S 8660
CAS:S 8660 is an analogue of brequinar sodium that inhibits the pyrimidine biosynthetic pathway.Formula:C23H16ClNO2Color and Shape:SolidMolecular weight:373.83
