
CAS 96201-88-6
:2-(2'-Fluoro-1,1'-biphenyl-4-yl)-6-fluoro-3-methylquinoline-4-carboxylic acid sodium salt
Description:
2-(2'-Fluoro-1,1'-biphenyl-4-yl)-6-fluoro-3-methylquinoline-4-carboxylic acid sodium salt, with the CAS number 96201-88-6, is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. This compound features a biphenyl moiety with a fluorine atom, contributing to its unique electronic properties and potential biological activity. The presence of the carboxylic acid group, which is deprotonated to form the sodium salt, enhances its solubility in aqueous environments, making it suitable for various applications in pharmaceuticals and materials science. The fluorine substitutions are known to influence the compound's lipophilicity and reactivity, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit interesting photophysical properties due to its aromatic structure, which can be relevant in the development of fluorescent probes or sensors. Overall, this compound's distinctive features make it a subject of interest in research and development within the fields of medicinal chemistry and organic synthesis.
Formula:C23H14F2NNaO2
InChI:InChI=1/C23H15F2NO2.Na/c1-13-21(23(27)28)18-12-16(24)10-11-20(18)26-22(13)15-8-6-14(7-9-15)17-4-2-3-5-19(17)25;/h2-12H,1H3,(H,27,28);/q;+1/p-1
SMILES:Cc1c(c2cc(ccc2nc1c1ccc(cc1)c1ccccc1F)F)C(=O)O.[Na]
Synonyms:- Brequinar sodium
- Nsc-368390
- DuP-785
- Sodium 6-Fluoro-2-(2'-Fluorobiphenyl-4-Yl)-3-Methylquinoline-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Quinolinecarboxylic acid,6-fluoro-2-(2'-fluoro[1,1'-biphenyl]-4-yl)-3-methyl-, sodium salt
CAS:Formula:C23H14F2NNaO2Purity:95%Color and Shape:SolidMolecular weight:397.3493Sodium 6-Fluoro-2-(2'-Fluoro-[1,1'-Biphenyl]-4-Yl)-3-Methylquinoline-4-Carboxylate
CAS:Sodium 6-Fluoro-2-(2'-Fluoro-[1,1'-Biphenyl]-4-Yl)-3-Methylquinoline-4-CarboxylatePurity:≥98%Molecular weight:397.35g/molBrequinar sodium
CAS:Bipenquinate is a potent and selective inhibitor of dihydroorotate dehydrogenase (DHODH) with IC50 of 20 nM, blocking de novo pyrimidine biosynthesis.Formula:C23H14F2NNaO2Purity:98.16%Color and Shape:SolidMolecular weight:397.36SODIUM 6-FLUORO-2-(2′-FLUORO-[1,1′-BIPHENYL]-4-YL)-3-METHYLQUINOLINE-4-CARBOXYLATE
CAS:Formula:C23H14F2NNaO2Purity:≥98%Molecular weight:397.357Brequinar Sodium
CAS:Controlled ProductFormula:C23H14F2NO2NaColor and Shape:NeatMolecular weight:397.35




