CAS 96222-36-5

Methyl 2,4-dioxo-2H-3,1-benzoxazine-1(4H)-acetate

Description:

Methyl 2,4-dioxo-2H-3,1-benzoxazine-1(4H)-acetate, with the CAS number 96222-36-5, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzoxazine and an acetate moiety. This compound typically exhibits a range of functional groups, including carbonyls and esters, which contribute to its reactivity and potential applications in organic synthesis. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where derivatives may exhibit antimicrobial or anticancer properties. The presence of the dioxo groups suggests potential for chelation with metal ions, which can influence its behavior in various chemical environments. Additionally, the methyl ester functionality may enhance solubility in organic solvents, making it suitable for various applications in research and industry. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology, with ongoing research aimed at elucidating its full potential and mechanisms of action.

Formula: C₁₁H₉NO₅

InChI: InChI=1S/C11H9NO5/c1-16-9(13)6-12-8-5-3-2-4-7(8)10(14)17-11(12)15/h2-5H,6H2,1H3

InChI key: InChIKey=BUMUWURIRIGJAH-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C=2C(C(=O)OC1=O)=CC=CC2

Synonyms:

• (2,4-Dioxo-4H-benzo[d][1,3]oxazin-1-yl)-acetic acid methyl ester
• Methyl 2,4-dioxo-2H-3,1-benzoxazine-1(4H)-acetate
• 2H-3,1-Benzoxazine-1(4H)-acetic acid, 2,4-dioxo-, methyl ester