CAS 96232-41-6

2-[(Dimetylamino)methylene]-3-(4-methylphenyl)-3-oxo-propanenitrile

Description:

2-[(Dimethylamino)methylene]-3-(4-methylphenyl)-3-oxo-propanenitrile, with the CAS number 96232-41-6, is an organic compound characterized by its complex structure, which includes a dimethylamino group, a ketone, and a nitrile functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the dimethylamino group suggests it may exhibit basic properties, while the nitrile and ketone functionalities can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the aromatic 4-methylphenyl group contributes to the compound's stability and may influence its electronic properties. The compound's reactivity and solubility can vary based on the solvent and conditions used, making it a versatile candidate for further chemical exploration. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1/C13H14N2O/c1-10-4-6-11(7-5-10)13(16)12(8-14)9-15(2)3/h4-7,9H,1-3H3/b12-9+

Synonyms:

• (2E)-3-(dimethylamino)-2-(4-methylbenzoyl)prop-2-enenitrile

2-[(Dimethylamino)methylene]-3-(4-methylphenyl)-3-oxo-propanenitrile

CAS: 96232-41-6

Formula: C₁₃H₁₄N₂O

Color and Shape: Solid

Molecular weight: 214.2631

Ref: IN-DA005VC0

2-[(Dimethylamino)methylene]-3-(4-methylphenyl)-3-oxopropanenitrile

CAS: 96232-41-6

2-[(Dimethylamino)methylene]-3-(4-methylphenyl)-3-oxopropanenitrile

Purity: ≥95%

Molecular weight: 214.26g/mol

Ref: 54-OR1634