CAS 96232-90-5

Methyl N-(4-cyanobutyl)carbamate

Description:

Methyl N-(4-cyanobutyl)carbamate is an organic compound characterized by its carbamate functional group, which consists of a methyl ester linked to an amine. This compound features a cyanobutyl side chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the cyanide group imparts certain reactivity, making it of interest in various chemical syntheses and applications. Methyl N-(4-cyanobutyl)carbamate is soluble in organic solvents, which enhances its utility in organic reactions. It may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. The compound's structure allows for potential applications in agrochemicals, pharmaceuticals, or as an intermediate in organic synthesis. As with many carbamates, it may also undergo hydrolysis in the presence of water, leading to the formation of corresponding amines and acids. Overall, its unique structure and properties make it a compound of interest in both research and industrial contexts.

Formula: C₇H₁₂N₂O₂

InChI: InChI=1S/C7H12N2O2/c1-11-7(10)9-6-4-2-3-5-8/h2-4,6H2,1H3,(H,9,10)

InChI key: InChIKey=CGWUSLSXMSPPJK-UHFFFAOYSA-N

SMILES: C(NC(OC)=O)CCCC#N

Synonyms:

• Methyl N-(4-cyanobutyl)carbamate
• Carbamic acid, N-(4-cyanobutyl)-, methyl ester
• Carbamic acid, (4-cyanobutyl)-, methyl ester