CAS 96249-05-7

(E)-3-(dimethylamino)-2-(3-fluorobenzoyl)prop-2-enenitrile

Description:

(E)-3-(dimethylamino)-2-(3-fluorobenzoyl)prop-2-enenitrile, with the CAS number 96249-05-7, is an organic compound characterized by its unique structural features. It contains a prop-2-enenitrile backbone, which is a conjugated system that contributes to its reactivity and potential applications in organic synthesis. The presence of a dimethylamino group enhances its basicity and may influence its solubility in various solvents. Additionally, the 3-fluorobenzoyl moiety introduces a fluorine atom, which can affect the compound's electronic properties and lipophilicity, potentially impacting its biological activity. This compound may exhibit interesting optical properties due to its conjugated double bond system, making it a candidate for studies in materials science or medicinal chemistry. Its reactivity can be influenced by the presence of both the nitrile and the aromatic groups, allowing for various chemical transformations. Overall, this compound's unique structure and functional groups suggest potential utility in various chemical applications, including drug development and organic synthesis.

Formula: C₁₂H₁₁FN₂O

InChI: InChI=1/C12H11FN2O/c1-15(2)8-10(7-14)12(16)9-4-3-5-11(13)6-9/h3-6,8H,1-2H3/b10-8+

Synonyms:

• (2E)-3-(Dimethylamino)-2-(3-fluorobenzoyl)acrylonitrile