CAS 96253-10-0
:1-[(1R,2R,4R,5R)-2-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-4-yl]pyrimidine-2,4-dione
Description:
The chemical substance known as 1-[(1R,2R,4R,5R)-2-(trityloxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-4-yl]pyrimidine-2,4-dione, with the CAS number 96253-10-0, is a complex organic compound characterized by its bicyclic structure and the presence of a pyrimidine ring. This compound features a trityloxymethyl group, which contributes to its stability and solubility in organic solvents. The bicyclic framework includes two oxygen atoms, indicating the presence of dioxabicyclo functionality, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The stereochemistry, denoted by the (1R,2R,4R,5R) configuration, suggests specific spatial arrangements that may affect the compound's biological activity and interactions with other molecules. Overall, this substance may exhibit interesting properties due to its unique structural features, making it a candidate for further research in various chemical and pharmaceutical applications.
Formula:C28H24N2O5
InChI:InChI=1/C28H24N2O5/c31-23-16-17-30(27(32)29-23)26-25-24(35-25)22(34-26)18-33-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,24-26H,18H2,(H,29,31,32)/t22-,24-,25-,26-/m1/s1
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)OC[C@@H]1[C@@H]2[C@H]([C@H](n3ccc(nc3=O)O)O1)O2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.