CymitQuimica logo

CAS 96254-05-6

:

2-(trifluoroacetoxy)pyridine

Description:
2-(Trifluoroacetoxy)pyridine is an organic compound characterized by the presence of a pyridine ring substituted with a trifluoroacetoxy group. This compound typically exhibits a pale yellow to colorless appearance and is known for its polar nature due to the electronegative fluorine atoms in the trifluoroacetoxy moiety. It has a moderate to high solubility in polar organic solvents, making it useful in various chemical reactions and applications. The trifluoroacetoxy group contributes to its reactivity, particularly in nucleophilic substitution and acylation reactions. Additionally, the compound may exhibit unique properties such as enhanced stability and selectivity in certain chemical processes due to the influence of the trifluoroacetyl group. Safety considerations should be taken into account, as trifluoroacetoxy compounds can be hazardous, necessitating proper handling and storage protocols. Overall, 2-(trifluoroacetoxy)pyridine is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C7H4F3NO2
InChI:InChI=1/C7H4F3NO2/c8-7(9,10)6(12)13-5-3-1-2-4-11-5/h1-4H
SMILES:c1ccnc(c1)OC(=O)C(F)(F)F
Synonyms:
  • Pyridin-2-Yl Trifluoroacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.