CymitQuimica logo

CAS 96259-02-8

:

dl-phenylalanine-beta,beta-D2

Description:
dl-Phenylalanine-beta,beta-D2, with the CAS number 96259-02-8, is a deuterated form of the amino acid phenylalanine, which is an essential amino acid important for protein synthesis and the production of neurotransmitters. This specific compound features deuterium (D) isotopes at the beta positions of the phenylalanine molecule, which can be useful in various biochemical and pharmacological studies, particularly in tracing metabolic pathways and understanding drug interactions. The presence of deuterium can alter the physical and chemical properties of the compound, such as its stability and reactivity, compared to its non-deuterated counterpart. As a racemic mixture, dl-phenylalanine consists of both the D- and L- enantiomers, which may exhibit different biological activities. This compound is often utilized in research settings, particularly in studies involving metabolism, neurochemistry, and the synthesis of labeled compounds for analytical purposes. Its unique isotopic labeling makes it a valuable tool in the field of medicinal chemistry and metabolic research.
Formula:C9H9D2NO2
InChI:InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i6D2
SMILES:c1ccc(cc1)C(C(C(=O)O)N)([2H])[2H]
Synonyms:
  • (β,β-2H2)phenylalanine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.