CAS 96259-28-8

Ethyl 6-chloro-3-(methylthio)-1,2,4-triazine-5-carboxylate

Description:

Ethyl 6-chloro-3-(methylthio)-1,2,4-triazine-5-carboxylate is a chemical compound belonging to the class of triazines, which are heterocyclic compounds containing three nitrogen atoms in a six-membered ring. This particular compound features a chloro substituent and a methylthio group, which contribute to its unique chemical properties. It is typically characterized by its moderate to high stability under standard conditions, making it suitable for various applications, including agricultural chemistry as a potential herbicide or fungicide. The presence of the ethyl ester group enhances its solubility in organic solvents, facilitating its use in formulations. Additionally, the compound may exhibit biological activity, which is often assessed through various assays to determine its efficacy and safety. As with many triazine derivatives, it is essential to handle this compound with care, adhering to safety guidelines due to potential toxicity and environmental impact. Overall, Ethyl 6-chloro-3-(methylthio)-1,2,4-triazine-5-carboxylate represents a significant compound in the field of agrochemicals and synthetic chemistry.

Formula: C₇H₈ClN₃O₂S

InChI: InChI=1S/C7H8ClN3O2S/c1-3-13-6(12)4-5(8)10-11-7(9-4)14-2/h3H2,1-2H3

InChI key: InChIKey=IDPWPXUCACWUGB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NC(SC)=NN=C1Cl

Synonyms:

• 1,2,4-Triazine-5-carboxylic acid, 6-chloro-3-(methylthio)-, ethyl ester
• Ethyl 6-chloro-3-(methylthio)-1,2,4-triazine-5-carboxylate