CymitQuimica logo

CAS 96291-04-2

:

4H-1-Benzopyran-4-one, 2-[2,3-dihydro-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-4-benzofuranyl]-2,3-dihydro-5,7-dihydroxy-

Description:
The chemical substance known as "4H-1-Benzopyran-4-one, 2-[2,3-dihydro-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-4-benzofuranyl]-2,3-dihydro-5,7-dihydroxy-" with CAS number 96291-04-2 is a complex organic compound characterized by its polyphenolic structure. It features a benzopyran core, which is a fused ring system that includes both aromatic and heterocyclic components. This compound exhibits multiple hydroxyl groups, contributing to its potential antioxidant properties and biological activity. The presence of methoxy and hydroxy substituents on the aromatic rings enhances its reactivity and solubility in various solvents. Such compounds are often studied for their pharmacological properties, including anti-inflammatory and anticancer activities. Additionally, the intricate structure suggests potential interactions with biological targets, making it a subject of interest in medicinal chemistry and natural product research. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C25H22O9
InChI:InChI=1S/C25H22O9/c1-32-20-6-11(2-4-15(20)28)24-14(10-26)22-13(3-5-16(29)25(22)34-24)19-9-18(31)23-17(30)7-12(27)8-21(23)33-19/h2-8,14,19,24,26-30H,9-10H2,1H3
InChI key:InChIKey=ODFCTVKAFKIYJI-UHFFFAOYSA-N
SMILES:C(O)C1C2=C(C=CC(O)=C2OC1C3=CC(OC)=C(O)C=C3)C4OC=5C(C(=O)C4)=C(O)C=C(O)C5
Synonyms:
  • 4H-1-Benzopyran-4-one, 2-[2,3-dihydro-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-4-benzofuranyl]-2,3-dihydro-5,7-dihydroxy-
  • Neosilyhermin A
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.