
CAS 963-03-1
:4-Chloro-N-[(cyclohexylamino)carbonyl]benzenesulfonamide
Description:
4-Chloro-N-[(cyclohexylamino)carbonyl]benzenesulfonamide, with the CAS number 963-03-1, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a chloro substituent on the benzene ring, which can influence its reactivity and biological activity. The presence of the cyclohexylamino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The sulfonamide moiety is typically associated with the inhibition of bacterial folic acid synthesis, contributing to its pharmacological profile. Additionally, the compound's structure indicates it may exhibit moderate solubility in polar solvents, while its lipophilic cyclohexyl group could enhance membrane permeability. Overall, 4-Chloro-N-[(cyclohexylamino)carbonyl]benzenesulfonamide is a compound that combines features of both aromatic and aliphatic chemistry, potentially leading to diverse applications in pharmaceuticals and agrochemicals.
Formula:C13H17ClN2O3S
InChI:InChI=1S/C13H17ClN2O3S/c14-10-6-8-12(9-7-10)20(18,19)16-13(17)15-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H2,15,16,17)
InChI key:InChIKey=TYZHJGCYLYXPSB-UHFFFAOYSA-N
SMILES:S(NC(NC1CCCCC1)=O)(=O)(=O)C2=CC=C(Cl)C=C2
Synonyms:- Urea, 1-[(p-chlorophenyl)sulfonyl]-3-cyclohexyl-
- Benzenesulfonamide, 4-chloro-N-[(cyclohexylamino)carbonyl]-
- 1-(p-Chlorobenzenesulfonyl)-3-cyclohexylurea
- K 694
- 4-Chloro-N-[(cyclohexylamino)carbonyl]benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chlorcyclohexamide
CAS:<p>Chlorcyclohexamide is a bioactive chemical</p>Formula:C13H17ClN2O3SColor and Shape:SolidMolecular weight:316.80
