CAS 96314-96-4
:2-[4-[Bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]phenyl]-1H-indole-6-carboxylic acid
Description:
The chemical substance known as 2-[4-[Bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]phenyl]-1H-indole-6-carboxylic acid, with the CAS number 96314-96-4, is a complex organic compound characterized by its multifunctional structure. It features multiple carboxymethyl groups, which enhance its solubility in water and contribute to its potential as a chelating agent. The presence of an indole moiety suggests potential biological activity, as indole derivatives are often associated with various pharmacological properties. Additionally, the compound's structure includes phenolic and ether linkages, which may influence its reactivity and interaction with biological systems. Its intricate design indicates potential applications in fields such as medicinal chemistry, biochemistry, and materials science, particularly in the development of drug delivery systems or as a biochemical probe. Overall, this compound exemplifies the complexity and versatility of synthetic organic molecules in research and application.
Formula:C32H31N3O12
InChI:InChI=1S/C32H31N3O12/c1-18-2-6-24(34(14-28(36)37)15-29(38)39)26(10-18)46-8-9-47-27-13-20(5-7-25(27)35(16-30(40)41)17-31(42)43)22-11-19-3-4-21(32(44)45)12-23(19)33-22/h2-7,10-13,33H,8-9,14-17H2,1H3,(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)
InChI key:InChIKey=AMHAQOBUZCQMHN-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(CC(O)=O)C1=C(OCCOC2=C(N(CC(O)=O)CC(O)=O)C=CC(C)=C2)C=C(C=C1)C=3NC=4C(C3)=CC=C(C(O)=O)C4
Synonyms:- 1H-Indole-6-carboxylic acid, 2-(4-(bis(carboxymethyl)amino)-3-(2-(2-(bis(carboxymethyl)amino)-5-methylphenoxy)ethoxy)phenyl)-
- 2-(4-(Bis(carboxymethyl)amino)-3-(2-(2-(bis(carboxymethyl)amino)-5-methylphenoxy)ethoxy)phenyl)-1H-indole-6-carboxylic acid
- Indo 1
- Indo 1
- Indo-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.