CAS 96315-06-9

Benzene, 1,1′-[1,2-ethanediylbis(oxy)]bis[5-methyl-2-nitro-

Description:

Benzene, 1,1′-[1,2-ethanediylbis(oxy)]bis[5-methyl-2-nitro-] is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with nitro and methyl groups, as well as an ether linkage through an ethanediyl group. This compound is part of a larger class of nitro-substituted aromatic compounds, which are known for their diverse applications in organic synthesis and materials science. The presence of the nitro group typically imparts significant reactivity, making it a potential candidate for further chemical transformations. Additionally, the methyl groups contribute to the compound's hydrophobic characteristics, influencing its solubility and interaction with other substances. The ether functionality suggests potential for hydrogen bonding and solvation effects. Overall, this compound's unique structural features may lead to interesting physical and chemical properties, including stability, reactivity, and potential applications in various fields such as pharmaceuticals, agrochemicals, and polymer science. However, specific safety and handling guidelines should be followed due to the presence of nitro groups, which can pose health risks.

Formula: C₁₆H₁₆N₂O₆

InChI: InChI=1S/C16H16N2O6/c1-11-3-5-13(17(19)20)15(9-11)23-7-8-24-16-10-12(2)4-6-14(16)18(21)22/h3-6,9-10H,7-8H2,1-2H3

InChI key: InChIKey=LVSOUJWCHNZHTG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OCCOC2=C(N(=O)=O)C=CC(C)=C2)C=C(C)C=C1

Synonyms:

• Benzene, 1,1′-[1,2-ethanediylbis(oxy)]bis[5-methyl-2-nitro-

1,1'-[1,2-Ethanediylbis(oxy)]bis[5-methyl-2-nitro-benzene]

Controlled Product

CAS: 96315-06-9

Applications 1,1'-[1,2-Ethanediylbis(oxy)]bis[5-methyl-2-nitro-benzene] is an intermediate in they synthesis of 5-Methyl-bis-(2-aminophenoxymethylene)-N,N,N’,N’-tetraacetate Methyl Ester

Formula: C₁₆H₁₅N·C₄H₄O₄

Color and Shape: Neat

Molecular weight: 337.369

Ref: TR-E890155