CAS 96315-08-1

4-methyl-1-nitro-2-[2-(2-nitrophenoxy)ethoxy]benzene

Description:

4-Methyl-1-nitro-2-[2-(2-nitrophenoxy)ethoxy]benzene, with the CAS number 96315-08-1, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a methyl group, a nitro group, and an ether linkage. This compound features a nitrophenoxy group attached to an ethoxy chain, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of nitro groups typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and stability. Additionally, the ether functionality may enhance solubility in organic solvents. The compound's molecular structure suggests potential for interactions with biological systems, making it of interest for research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of substituents and the overall molecular weight. As with many nitro compounds, safety considerations regarding toxicity and environmental impact are essential when handling or utilizing this substance.

Formula: C₁₅H₁₄N₂O₆

InChI: InChI=1/C15H14N2O6/c1-11-6-7-13(17(20)21)15(10-11)23-9-8-22-14-5-3-2-4-12(14)16(18)19/h2-7,10H,8-9H2,1H3

SMILES: Cc1ccc(c(c1)OCCOc1ccccc1N(=O)=O)N(=O)=O

Synonyms:

• 4-Methyl-1-nitro-2-[2-(2-nitrophenoxy)ethoxy]-benzene

1-(5-Methyl-2-nitrophenoxy)-2-(2-nitrophenoxy)ethane

Controlled Product

CAS: 96315-08-1

Applications 1-(5-Methyl-2-nitrophenoxy)-2-(2-nitrophenoxy)ethane is an impurity in the synthesis of 5-Methyl-bis-(2-aminophenoxymethylene)-N,N,N’,N’-tetraacetate Methyl Ester (M294140).

Formula: C₁₅H₁₄N₂O₆

Color and Shape: Neat

Molecular weight: 318.28

Ref: TR-M323455