CymitQuimica logo

CAS 96331-95-2

:

2-[2-(2-aminophenoxy)ethoxy]-4-methylaniline

Description:
2-[2-(2-Aminophenoxy)ethoxy]-4-methylaniline, with the CAS number 96331-95-2, is an organic compound characterized by its complex structure that includes an aniline moiety, an ether linkage, and an amino group. This compound typically exhibits properties associated with amines, such as being a potential base and having the ability to form hydrogen bonds due to the presence of both amino and ether functional groups. It is likely to be soluble in polar solvents, given the presence of the amino group, which can engage in hydrogen bonding with the solvent. The compound may also exhibit moderate to high reactivity due to the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the methylaniline group suggests that it may have some hydrophobic characteristics, influencing its solubility and interaction with other substances. Overall, this compound may find applications in fields such as pharmaceuticals or materials science, where its unique structural features can be leveraged for specific functionalities.
Formula:C15H18N2O2
InChI:InChI=1/C15H18N2O2/c1-11-6-7-13(17)15(10-11)19-9-8-18-14-5-3-2-4-12(14)16/h2-7,10H,8-9,16-17H2,1H3
SMILES:Cc1ccc(c(c1)OCCOc1ccccc1N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.