CAS 96335-43-2

5-Amino-2-methylpyrazolo[1,5-a]pyrimidin-7(4H)-one

Description:

5-Amino-2-methylpyrazolo[1,5-a]pyrimidin-7(4H)-one is a heterocyclic compound characterized by its pyrazolo and pyrimidine ring systems. This compound features an amino group at the 5-position and a methyl group at the 2-position of the pyrazolo ring, contributing to its unique chemical properties. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including anti-inflammatory and anti-cancer properties. Its structure allows for various chemical modifications, which can enhance its pharmacological profile. The presence of nitrogen atoms in the rings contributes to its basicity and reactivity, making it a versatile building block in organic synthesis. As with many nitrogen-containing heterocycles, it may also exhibit tautomerism, influencing its reactivity and interactions in biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₈N₄O

InChI: InChI=1S/C7H8N4O/c1-4-2-6-9-5(8)3-7(12)11(6)10-4/h2-3,9H,8H2,1H3

InChI key: InChIKey=ACFPCCPCUNSYHG-UHFFFAOYSA-N

SMILES: O=C1N2C(=CC(C)=N2)NC(N)=C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidin-7(4H)-one, 5-amino-2-methyl-
• 5-Amino-2-methylpyrazolo[1,5-a]pyrimidin-7(4H)-one

5-Amino-2-methyl-4H,7H-pyrazolo[1,5-a]pyrimidin-7-one

CAS: 96335-43-2

Versatile small molecule scaffold

Formula: C₇H₈N₄O

Purity: Min. 95%

Molecular weight: 164.16 g/mol

Ref: 3D-WDA33543