
CAS 96356-07-9
:Ethyl 2-ethylimidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylate
Description:
Ethyl 2-ethylimidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylate is a heterocyclic compound characterized by its unique structure, which includes an imidazo-thiadiazole ring system. This compound features a carboxylate functional group and an ethyl ester, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of sulfur and nitrogen in its ring structure imparts distinctive chemical properties, such as the ability to participate in various reactions, including nucleophilic substitutions and cycloadditions. Ethyl 2-ethylimidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylate may exhibit biological activity, making it of interest for research in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a class of heterocycles that are valuable for their diverse chemical properties and potential utility in synthetic chemistry.
Formula:C9H11N3O2S
InChI:InChI=1S/C9H11N3O2S/c1-3-7-11-12-5-6(8(13)14-4-2)10-9(12)15-7/h5H,3-4H2,1-2H3
InChI key:InChIKey=HLKYLRBQFQLDQA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C2N(C1)N=C(CC)S2
Synonyms:- Ethyl 2-ethylimidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylate
- Imidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylic acid, 2-ethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.