CymitQuimica logo

CAS 96382-90-0

:

Oleuropeinic acid

Description:
Oleuropeinic acid is a phenolic compound primarily found in olive leaves and olives, known for its potential health benefits and antioxidant properties. It is characterized by its molecular formula, which includes multiple hydroxyl groups, contributing to its solubility in polar solvents. The compound exhibits a bitter taste, which is often associated with the flavor profile of olive oil. Oleuropeinic acid is recognized for its anti-inflammatory, antimicrobial, and cardioprotective effects, making it a subject of interest in nutritional and medicinal research. Its structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, which allows it to interact with various biological pathways. Additionally, oleuropeinic acid has been studied for its potential role in preventing chronic diseases, including cardiovascular diseases and certain types of cancer. As a natural compound, it is often explored for its applications in functional foods and dietary supplements, highlighting its significance in promoting health and wellness.
Formula:C25H30O15
InChI:InChI=1S/C25H30O15/c1-36-23(35)14-10-38-24(40-25-22(34)21(33)20(32)17(9-26)39-25)13(7-18(29)30)12(14)8-19(31)37-5-4-11-2-3-15(27)16(28)6-11/h2-3,6-7,10,12,17,20-22,24-28,32-34H,4-5,8-9H2,1H3,(H,29,30)/b13-7+/t12?,17-,20-,21+,22-,24?,25+/m1/s1
InChI key:XJDJODWHDUVAGF-HITGIGKYSA-N
SMILES:COC(=O)C1=COC(/C(=C/C(=O)O)/C1CC(=O)OCCC2=CC(=C(C=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O
Synonyms:
  • Oleuropeinic acid >=85% (LC/MS-ELSD)
  • Oleuropeinic acid
Found 5 products.