
CAS 96389-68-3
:Crisnatol
Description:
Crisnatol, identified by its CAS number 96389-68-3, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its specific molecular structure, which includes a hydroxyl group (-OH) attached to an aromatic ring, contributing to its chemical reactivity and potential applications. Crisnatol is known for its role in various chemical reactions, particularly in organic synthesis and as a potential intermediate in the production of other chemical substances. Its properties may include moderate solubility in organic solvents and varying stability under different environmental conditions. Additionally, like many phenolic compounds, Crisnatol may exhibit biological activity, which could be of interest in pharmacological research. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with safety regulations. Overall, Crisnatol's unique characteristics make it a subject of interest in both industrial and research settings.
Formula:C23H23NO2
InChI:InChI=1S/C23H23NO2/c1-23(14-25,15-26)24-13-17-12-22-18-7-3-2-6-16(18)10-11-21(22)20-9-5-4-8-19(17)20/h2-12,24-26H,13-15H2,1H3
InChI key:InChIKey=SBRXTSOCZITGQG-UHFFFAOYSA-N
SMILES:C(NC(CO)(CO)C)C1=CC2=C(C=3C1=CC=CC3)C=CC=4C2=CC=CC4
Synonyms:- Crisnatol
- BW-A 770U
- 770U82
- 1,3-Propanediol, 2-[(6-chrysenylmethyl)amino]-2-methyl-
- 2-[(6-Chrysenylmethyl)amino]-2-methyl-1,3-propanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Crisnatol
CAS:Crisnatol (BWA770U) is an oral anticancer DNA intercalator, toxic to breast cancer cells, not skin fibroblasts.Formula:C23H23NO2Color and Shape:SolidMolecular weight:345.43
