CAS 964-08-9
:4-benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide
Description:
4-benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide, commonly referred to by its CAS number 964-08-9, is a chemical compound characterized by its unique bicyclic structure that incorporates a benzothiadiazin moiety. This compound features a benzyl group attached to the nitrogen of the thiadiazin ring, contributing to its chemical properties and potential biological activity. It is typically a solid at room temperature and is known for its stability under standard conditions. The presence of the sulfonyl group (the 1,1-dioxide) enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, compounds of this class have been studied for their pharmacological properties, including potential use as antihypertensive agents. However, specific reactivity and interaction profiles can vary, necessitating further investigation for practical applications. Safety data should be consulted before handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H12N2O3S
InChI:InChI=1/C14H12N2O3S/c17-14-15-20(18,19)13-9-5-4-8-12(13)16(14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17)
SMILES:c1ccc(cc1)CN1c2ccccc2S(=O)(=O)N=C1O
Synonyms:- 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.