CAS 964-08-9

4-benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide

Description:

4-benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide, commonly referred to by its CAS number 964-08-9, is a chemical compound characterized by its unique bicyclic structure that incorporates a benzothiadiazin moiety. This compound features a benzyl group attached to the nitrogen of the thiadiazin ring, contributing to its chemical properties and potential biological activity. It is typically a solid at room temperature and is known for its stability under standard conditions. The presence of the sulfonyl group (the 1,1-dioxide) enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, compounds of this class have been studied for their pharmacological properties, including potential use as antihypertensive agents. However, specific reactivity and interaction profiles can vary, necessitating further investigation for practical applications. Safety data should be consulted before handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₂N₂O₃S

InChI: InChI=1/C14H12N2O3S/c17-14-15-20(18,19)13-9-5-4-8-12(13)16(14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17)

SMILES: c1ccc(cc1)CN1c2ccccc2S(=O)(=O)N=C1O

Synonyms:

• 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-one 1,1-dioxide