CAS 964-42-1

1,3-diphenyl-1H-pyrazole-5-carboxylic acid

Description:

1,3-Diphenyl-1H-pyrazole-5-carboxylic acid, with the CAS number 964-42-1, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two phenyl groups attached to the pyrazole ring at the 1 and 3 positions, and a carboxylic acid functional group at the 5 position, contributing to its acidic properties. It is typically a white to off-white crystalline solid, and its solubility can vary depending on the solvent used, often being more soluble in organic solvents than in water. The presence of the carboxylic acid group allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in the synthesis of other chemical entities. Its stability and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₁₆H₁₂N₂O₂

InChI: InChI=1/C16H12N2O2/c19-16(20)15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-11H,(H,19,20)

SMILES: c1ccc(cc1)c1cc(C(=O)O)n(c2ccccc2)n1

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 1,3-diphenyl-
• 2,5-Diphenyl-2H-pyrazole-3-carboxylic acid
• 1,3-diphenyl-1H-pyrazole-5-carboxylate

2,5-Diphenyl-2H-pyrazole-3-carboxylic acid

CAS: 964-42-1

Formula: C₁₆H₁₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.2787

Ref: IN-DA005UKY

1,3-Diphenyl-1H-pyrazole-5-carboxylic acid

CAS: 964-42-1

1,3-Diphenyl-1H-pyrazole-5-carboxylic acid

Purity: 98%

Molecular weight: 264.28g/mol

Ref: 54-OR1035945

1,3-Diphenyl-1H-pyrazole-5-carboxylic acid

CAS: 964-42-1

Purity: 95.0%

Molecular weight: 264.28399658203125

Ref: 10-F023810

2,5-Diphenyl-2H-pyrazole-3-carboxylic acid

Controlled Product

CAS: 964-42-1

Please enquire for more information about 2,5-Diphenyl-2H-pyrazole-3-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 264.28 g/mol

Ref: 3D-FD57108