CymitQuimica logo

CAS 964-82-9

:

α-2-Buten-1-yl[1,1′-biphenyl]-4-acetic acid

Description:
α-2-Buten-1-yl[1,1′-biphenyl]-4-acetic acid, with the CAS number 964-82-9, is an organic compound characterized by its unique structure that includes a butenyl group and a biphenyl moiety. This compound typically exhibits properties associated with both alkenes and aromatic compounds, such as moderate to high stability under standard conditions and potential reactivity due to the presence of the double bond in the butenyl group. It is likely to be a solid or viscous liquid at room temperature, depending on its specific molecular interactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the biphenyl structure may impart certain electronic properties, making it of interest in fields such as materials science and organic synthesis. Overall, α-2-Buten-1-yl[1,1′-biphenyl]-4-acetic acid is a compound with potential applications in organic chemistry and related disciplines.
Formula:C18H18O2
InChI:InChI=1S/C18H18O2/c1-2-3-9-17(18(19)20)16-12-10-15(11-13-16)14-7-5-4-6-8-14/h2-8,10-13,17H,9H2,1H3,(H,19,20)
InChI key:InChIKey=ZVRCODPBROUJIT-UHFFFAOYSA-N
SMILES:C(CC=CC)(C(O)=O)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-4-acetic acid, α-2-buten-1-yl-
  • α-2-Buten-1-yl[1,1′-biphenyl]-4-acetic acid
  • 2-(4-Biphenylyl)-4-hexenoic acid
  • [1,1′-Biphenyl]-4-acetic acid, α-2-butenyl-, (±)-
  • [1,1′-Biphenyl]-4-acetic acid, α-2-butenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.