CymitQuimica logo

CAS 96424-68-9

:

2-Bromo-3-chloropyridine

Description:
2-Bromo-3-chloropyridine is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring. The molecular structure consists of a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, with bromine attached to the second carbon and chlorine to the third. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the halogen atoms, which can serve as leaving groups. 2-Bromo-3-chloropyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to act as an intermediate in various chemical reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its potential toxicity and environmental impact.
Formula:C5H3BrClN
InChI:InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H
InChI key:GOHBBINNYAWQGO-UHFFFAOYSA-N
SMILES:c1cc(c(Br)nc1)Cl
Found 6 products.