CAS 96428-16-9

8-(benzyloxy)imidazo[1,2-a]pyridine

Description:

8-(Benzyloxy)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which features a fused ring system containing nitrogen atoms. The presence of the benzyloxy group at the 8-position enhances its solubility and may influence its biological activity. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may participate in various chemical reactions due to the reactivity of the imidazole ring. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as imidazo[1,2-a]pyridine derivatives have been explored for their biological activities, including antimicrobial and anticancer properties. The compound's molecular interactions can be influenced by the benzyloxy substituent, which may also affect its pharmacokinetic properties. Overall, 8-(benzyloxy)imidazo[1,2-a]pyridine represents a versatile scaffold for further chemical modifications and research in drug discovery.

Formula: C₁₄H₁₂N₂O

InChI: InChI=1/C14H12N2O/c1-2-5-12(6-3-1)11-17-13-7-4-9-16-10-8-15-14(13)16/h1-10H,11H2

SMILES: c1ccc(cc1)COc1cccn2ccnc12

8-(Benzyloxy)imidazo[1,2-a]pyridine

CAS: 96428-16-9

Formula: C₁₄H₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 224.2579

Ref: IN-DA00674A

8-(Benzyloxy)imidazo[1,2-a]pyridine

CAS: 96428-16-9

8-(Benzyloxy)imidazo[1,2-a]pyridine

Purity: 95%

Molecular weight: 224.26g/mol

Ref: 54-OR33317

8-(Benzyloxy)imidazo[1,2-a]pyridine

CAS: 96428-16-9

8-(Benzyloxy)imidazo[1,2-a]pyridine is a potent and selective bradykinin B2 receptor antagonist. It is an orally active compound that has been found to be absorbed in the gastrointestinal tract. 8-(Benzyloxy)imidazo[1,2-a]pyridine has shown antagonistic activities against bradykinin B2 receptors by binding to the receptor’s nucleophilic site. This binding causes a conformational change in the receptor, preventing it from being activated. 8-(Benzyloxy)imidazo[1,2-a]pyridine also has a high affinity for the bradykinin B2 receptor and can be used as an organocatalyst in organic chemistry reactions.

Formula: C₁₄H₁₂N₂O

Purity: Min. 95%

Molecular weight: 224.26 g/mol

Ref: 3D-WDA42816