CAS 96437-13-7

2-(Chloromethyl)-1-methylnaphthalene

Description:

2-(Chloromethyl)-1-methylnaphthalene is an organic compound characterized by its naphthalene structure, which consists of two fused aromatic rings. The presence of a chloromethyl group (-CH2Cl) at the 2-position and a methyl group (-CH3) at the 1-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The chloromethyl group makes it a potential electrophile, allowing it to participate in various chemical reactions, such as nucleophilic substitution. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chlorinated nature. Proper storage in a cool, dry place away from light is recommended to maintain its stability.

Formula: C₁₂H₁₁Cl

InChI: InChI=1S/C12H11Cl/c1-9-11(8-13)7-6-10-4-2-3-5-12(9)10/h2-7H,8H2,1H3

InChI key: InChIKey=HZODSUZFJLKBTE-UHFFFAOYSA-N

SMILES: CC=1C2=C(C=CC1CCl)C=CC=C2

Synonyms:

• Naphthalene, 2-(chloromethyl)-1-methyl-
• 1-Methyl-2-chloromethylnaphthalene
• 2-(Chloromethyl)-1-methylnaphthalene