CAS 96446-43-4

7-Ethyl-2-methyl-5-undecen-4-one

Description:

7-Ethyl-2-methyl-5-undecen-4-one, with the CAS number 96446-43-4, is an organic compound characterized by its unique structure, which includes a long carbon chain and a ketone functional group. This compound features a total of 14 carbon atoms, making it a member of the ketone family. Its molecular structure includes both ethyl and methyl substituents, contributing to its distinct chemical properties and reactivity. The presence of the double bond in the undecen chain indicates that it is an unsaturated ketone, which can influence its physical properties, such as boiling point and solubility. Typically, compounds like this may exhibit interesting olfactory characteristics, making them relevant in flavor and fragrance applications. Additionally, due to the presence of the ketone group, it may participate in various chemical reactions, including oxidation and reduction processes. Overall, 7-Ethyl-2-methyl-5-undecen-4-one is a versatile compound with potential applications in various fields, including organic synthesis and materials science.

Formula: C₁₄H₂₆O

InChI: InChI=1S/C14H26O/c1-5-7-8-13(6-2)9-10-14(15)11-12(3)4/h9-10,12-13H,5-8,11H2,1-4H3

InChI key: InChIKey=QYAOIOBFYSRSLB-UHFFFAOYSA-N

SMILES: C(C=CC(CC(C)C)=O)(CCCC)CC

Synonyms:

• 5-Undecen-4-one, 7-ethyl-2-methyl-
• 7-Ethyl-2-methyl-5-undecen-4-one
• 7-Ethyl-2-methylundec-5-en-4-one

Tetradecane Impurity 1

CAS: 96446-43-4

Formula: C₁₄H₂₆O

Molecular weight: 210.36

Ref: 4Z-T-294002

(E)-7-Ethyl-2-methylundec-5-en-4-one

Controlled Product

CAS: 96446-43-4

Formula: C₁₄H₂₆O

Color and Shape: Neat

Molecular weight: 210.356

Ref: TR-E897690