CAS 96450-55-4
:1-(2-Chloroethyl)-3-methyl-1H-pyrazole
Description:
1-(2-Chloroethyl)-3-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a chloroethyl group, which contributes to its reactivity and potential applications in various chemical processes. The presence of the methyl group on the pyrazole ring influences its physical and chemical properties, such as solubility and stability. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research or agrochemical applications. The chloroethyl moiety can participate in nucleophilic substitution reactions, enhancing its utility in synthetic chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety data and handling precautions are essential due to the presence of chlorine, which can impart toxicity. Overall, 1-(2-Chloroethyl)-3-methyl-1H-pyrazole is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C6H9ClN2
InChI:InChI=1S/C6H9ClN2/c1-6-2-4-9(8-6)5-3-7/h2,4H,3,5H2,1H3
InChI key:InChIKey=AURQGZNPLSCBKR-UHFFFAOYSA-N
SMILES:C(CCl)N1N=C(C)C=C1
Synonyms:- 1-(2-Chloroethyl)-3-methylpyrazole
- 1-(β-Chloroethyl)-3-methylpyrazole
- 1H-pyrazole, 1-(2-chloroethyl)-3-methyl-
- 1-(2-Chloroethyl)-3-methyl-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
