CymitQuimica logo

CAS 96451-28-4

:

10-Undecenoic acid, homopolymer

Description:
10-Undecenoic acid, homopolymer, is a polymer derived from the polymerization of 10-undecenoic acid, which is an unsaturated fatty acid. This substance typically exhibits characteristics such as being a viscous liquid or solid at room temperature, depending on its molecular weight and degree of polymerization. The polymer is known for its hydrophobic nature, making it less soluble in water but soluble in organic solvents. It possesses a long carbon chain, which contributes to its potential applications in surfactants, coatings, and adhesives due to its ability to form films and provide emulsifying properties. Additionally, the presence of unsaturation in the polymer backbone can allow for further chemical modifications, enhancing its functionality. The material is generally stable under normal conditions but may undergo degradation under extreme temperatures or in the presence of strong oxidizing agents. Overall, 10-undecenoic acid, homopolymer, is valued for its unique properties that can be tailored for various industrial applications.
Formula:(C11H20O2)x
InChI:InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13)
InChI key:InChIKey=FRPZMMHWLSIFAZ-UHFFFAOYSA-N
SMILES:C(CCCCC=C)CCCC(O)=O
Synonyms:
  • 10-Undecenoic acid, homopolymer
  • Poly(10-undecenoic acid)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.