
CAS 96459-08-4
:2-[2-[2-(9-Octadecen-1-yloxy)ethoxy]ethoxy]ethanol
Description:
2-[2-[2-(9-Octadecen-1-yloxy)ethoxy]ethoxy]ethanol, also known by its CAS number 96459-08-4, is a synthetic chemical compound characterized by its long hydrophobic hydrocarbon chain and hydrophilic ethylene glycol ether segments. This amphiphilic structure allows it to function effectively as a surfactant, facilitating the reduction of surface tension in various applications. The presence of the 9-octadecen-1-yloxy group, which is derived from oleic acid, contributes to its lipid-like properties, making it suitable for use in formulations that require emulsification or solubilization of oils in water. Additionally, the ethoxy groups enhance its solubility in aqueous environments, promoting its utility in personal care products, pharmaceuticals, and industrial applications. The compound's stability and compatibility with other ingredients are essential for maintaining the efficacy and performance of formulations. Overall, its unique structural characteristics make it a valuable component in various chemical and industrial processes.
Formula:C24H48O4
InChI:InChI=1S/C24H48O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-26-21-23-28-24-22-27-20-18-25/h9-10,25H,2-8,11-24H2,1H3
InChI key:InChIKey=KGULFLCOPRYBEV-UHFFFAOYSA-N
SMILES:C(CCCCOCCOCCOCCO)CCCC=CCCCCCCCC
Synonyms:- Ethanol, 2-[2-[2-(9-octadecenyloxy)ethoxy]ethoxy]-
- 2-[2-[2-(9-Octadecen-1-yloxy)ethoxy]ethoxy]ethanol
- Ethanol, 2-[2-[2-(9-octadecen-1-yloxy)ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
