CAS 96472-47-8

hexyl-[2-(2-hydroxyethylamino)ethoxy]borinic acid

Description:

Hexyl-[2-(2-hydroxyethylamino)ethoxy]borinic acid, with the CAS number 96472-47-8, is a boronic acid derivative characterized by its unique functional groups that include a hexyl chain and a hydroxyethylamino moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the hydroxyethylamino group suggests potential for biological activity, possibly enhancing solubility and reactivity in biological systems. Additionally, the hexyl group contributes to the lipophilicity of the molecule, which may influence its interaction with biological membranes. Overall, this compound's structure indicates potential utility in drug development and as a reagent in chemical reactions, particularly those involving the formation of boronate esters or in the context of targeted drug delivery systems. Further studies would be necessary to elucidate its specific reactivity and biological properties.

Formula: C₁₀H₂₄BNO₃

InChI: InChI=1/C10H24BNO3/c1-2-3-4-5-6-11(14)15-10-8-12-7-9-13/h12-14H,2-10H2,1H3

SMILES: CCCCCCB(O)OCCNCCO

Synonyms:

• 2-[(2-Hydroxyethyl)amino]ethyl hydrogen hexylboronate

2-Hexyl-1,3,6,2-dioxazaborocane

CAS: 96472-47-8

Formula: C₁₀H₂₂BNO₂

Purity: 95%

Molecular weight: 199.0982

Ref: IN-DA00IJTH