CAS 96478-43-2
:Irindalone
Description:
Irindalone, with the CAS number 96478-43-2, is a chemical compound that belongs to the class of organic molecules known as indoles. It is characterized by its unique bicyclic structure, which consists of a fused benzene and pyrrole ring. This compound is often studied for its potential biological activities, including antimicrobial and anticancer properties. Irindalone may exhibit various functional groups that contribute to its reactivity and interaction with biological systems. Its solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. As with many organic compounds, the synthesis of Irindalone typically involves multi-step reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy. Understanding the properties and behavior of Irindalone is essential for its application in medicinal chemistry and drug development. However, detailed safety and handling information should be consulted from reliable sources before working with this compound.
Formula:C24H29FN4O
InChI:InChI=1/C24H29FN4O/c25-19-7-5-18(6-8-19)22-17-23(21-4-2-1-3-20(21)22)28-14-11-27(12-15-28)13-16-29-10-9-26-24(29)30/h1-8,22-23H,9-17H2,(H,26,30)/t22-,23+/m0/s1
Synonyms:- Irindalone [INN]
- (+)-(1R,3S)-1-(2-(4-(3-(p-Fluorophenyl)-1-indanyl)-1-piperazinyl)ethyl)-2-imidazolidinone
- Irindalona
- Irindalona [Spanish]
- Irindalonum
- Irindalonum [Latin]
- Unii-4F39T8N10K
- 1-(2-{4-[(1R,3S)-3-(4-fluorophenyl)-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl}ethyl)imidazolidin-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Irindalone
CAS:Irindalone is a pharmacological compound, classified as a dopamine antagonist, which is developed from synthetic chemical processes. Its mode of action involves the inhibition of dopamine receptors, particularly in the central nervous system. By blocking these receptors, Irindalone alters dopamine-mediated neurotransmission, which may modulate various neurological pathways.
Formula:C24H29FN4OPurity:Min. 95%Molecular weight:408.5 g/molIrindalone
CAS:IrindaloneIrindalone is a potent serotonin (5-HT2) antagonist.Formula:C24H29FN4OPurity:98%Color and Shape:SolidMolecular weight:408.51

