CAS 96487-37-5
:Nuvenzepine
Description:
Nuvenzepine, identified by its CAS number 96487-37-5, is a chemical compound that belongs to the class of drugs known as antipsychotics. It is primarily characterized by its ability to modulate neurotransmitter activity in the brain, particularly affecting serotonin and dopamine receptors. This modulation can help in managing symptoms associated with various psychiatric disorders. Nuvenzepine is known for its relatively low side effect profile compared to other antipsychotics, making it a subject of interest in pharmacological research. The compound exhibits a unique chemical structure that contributes to its therapeutic effects, and it is typically administered in specific dosages to achieve the desired clinical outcomes. As with any medication, its use should be guided by a healthcare professional, considering potential interactions and individual patient factors. Further studies continue to explore its efficacy and safety in different populations, contributing to the understanding of its role in mental health treatment.
Formula:C19H20N4O2
InChI:InChI=1/C19H20N4O2/c1-22-11-8-13(9-12-22)19(25)23-16-7-3-2-6-15(16)21-18(24)14-5-4-10-20-17(14)23/h2-7,10,13H,8-9,11-12H2,1H3,(H,21,24)
SMILES:CN1CCC(CC1)C(=O)N1c2ccccc2N=C(c2cccnc12)O
Synonyms:- Nuvenzepine [INN]
- 6,11-Dihydro-11-(1-methylisonipecotoyl)-5H-pyrido(2,3-b)(1,5)benzodiazepin-5-one
- Nuvenzepina
- Nuvenzepina [INN-Spanish]
- Nuvenzepinum
- Nuvenzepinum [INN-Latin]
- Unii-8Omo7K4W74
- 11-[(1-methylpiperidin-4-yl)carbonyl]-6,11-dihydro-5H-pyrido[2,3-b][1,5]benzodiazepin-5-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
11-(1-Methylpiperidine-4-carbonyl)-6,11-dihydro-5H-benzo[b]pyrido[2,3-e][1,4]diazepin-5-one
CAS:11-(1-Methylpiperidine-4-carbonyl)-6,11-dihydro-5H-benzo[b]pyrido[2,3-e][1,4]diazepin-5-onePurity:99%Molecular weight:336.39g/molNuvenzepine
CAS:Nuvenzepine is a potent and selective muscarinic antagonist, synthesized from intricate chemical processes involving non-peptidic structures. Its primary mode of action involves inhibiting muscarinic acetylcholine receptors, particularly those located in the gastrointestinal tract. By impeding these receptors, Nuvenzepine effectively reduces gastric secretions and modulates smooth muscle activity.Formula:C19H20N4O2Purity:Min. 95%Molecular weight:336.4 g/molNuvenzepine
CAS:Nuvenzepine is an antagonist of mAChR. It has the potential for gastrospasm treatment.Formula:C19H20N4O2Purity:98%Color and Shape:SolidMolecular weight:336.39


