CAS 96497-73-3
:8-[2-(4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2-methyl-3-oxobutanoate
Description:
The chemical substance with the name "8-[2-(4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2-methyl-3-oxobutanoate" and CAS number 96497-73-3 is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a hexahydronaphthalene core, which contributes to its hydrophobic properties, while the presence of a tetrahydropyran moiety and a keto group indicates potential reactivity and biological activity. The hydroxyl group suggests the ability to form hydrogen bonds, enhancing solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability would depend on the specific conditions under which it is handled. Overall, this substance represents a unique scaffold that could be explored for various applications in drug development or as a chemical intermediate.
Formula:C24H34O6
InChI:InChI=1/C24H34O6/c1-13-9-17-6-5-14(2)20(8-7-19-11-18(26)12-22(27)29-19)23(17)21(10-13)30-24(28)15(3)16(4)25/h5-6,9,13-15,18-21,23,26H,7-8,10-12H2,1-4H3
SMILES:CC1C=C2C=CC(C)C(CCC3CC(CC(=O)O3)O)C2C(C1)OC(=O)C(C)C(=O)C
Synonyms:- Butanoic acid, 2-methyl-3-oxo-, 1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-(2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl)-1-naphthalenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Keto lovastatin
CAS:Keto lovastatin is an impurity of lovastatin with antibacterial properties. Lovastatin is a cell-permeable HMG-CoA reductase (HMG-CoA reductase) inhibitor used to reduce cholesterol levels.Formula:C24H34O6Color and Shape:SolidMolecular weight:418.523

