CAS 96504-22-2
:Benzene, 1-ethynyl-2-(trifluoromethyl)-, homopolymer
Description:
Benzene, 1-ethynyl-2-(trifluoromethyl)-, homopolymer, identified by CAS number 96504-22-2, is a synthetic polymer derived from the polymerization of a specific monomer that contains a benzene ring substituted with both an ethynyl group and a trifluoromethyl group. This compound exhibits several notable characteristics, including high thermal stability and resistance to chemical degradation, which make it suitable for various industrial applications. The presence of the trifluoromethyl group enhances its hydrophobic properties and contributes to its overall stability, while the ethynyl group can facilitate further chemical modifications. The polymer is typically insoluble in common organic solvents, which is a common trait among fluorinated polymers. Additionally, it may exhibit unique optical and electrical properties due to its conjugated structure. Overall, this homopolymer is of interest in fields such as materials science and engineering, particularly for applications requiring durable and chemically resistant materials.
Formula:(C9H5F3)x
InChI:InChI=1S/C9H5F3/c1-2-7-5-3-4-6-8(7)9(10,11)12/h1,3-6H
InChI key:InChIKey=OOZKONVIIMFOKW-UHFFFAOYSA-N
SMILES:C(#C)C1=C(C(F)(F)F)C=CC=C1
Synonyms:- Poly[o-(trifluoromethyl)phenylacetylene]
- o-(Trifluoromethyl)phenylacetylene homopolymer
- 1-Ethynyl-2-(trifluoromethyl)benzene homopolymer
- Benzene, 1-ethynyl-2-(trifluoromethyl)-, homopolymer
- Poly(2-(Trifluoromethyl)phenylacetylene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
