CAS 96507-72-1

Ethyl 4-chloro-3-formyl-5,6-dihydro-1(2H)-pyridinecarboxylate

Description:

Ethyl 4-chloro-3-formyl-5,6-dihydro-1(2H)-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a formyl group (-CHO) and an ethyl ester group (-COOEt), contributing to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The dihydropyridine structure indicates that it is partially saturated, which can influence its physical properties, such as solubility and boiling point. Ethyl 4-chloro-3-formyl-5,6-dihydro-1(2H)-pyridinecarboxylate may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it can serve as an intermediate in the preparation of more complex molecules. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₉H₁₂ClNO₃

InChI: InChI=1S/C9H12ClNO3/c1-2-14-9(13)11-4-3-8(10)7(5-11)6-12/h6H,2-5H2,1H3

InChI key: InChIKey=BMUCDCSKVFZPSS-UHFFFAOYSA-N

SMILES: C(OCC)(=O)N1CC(C=O)=C(Cl)CC1

Synonyms:

• 1(2H)-Pyridinecarboxylic acid, 4-chloro-3-formyl-5,6-dihydro-, ethyl ester
• Ethyl 4-chloro-3-formyl-5,6-dihydro-1(2H)-pyridinecarboxylate
• ethyl 4-chloro-5-formyl-3,6-dihydropyridine-1(2H)-carboxylate
• Ethyl 4-chloro-3-formyl-5,6-dihydro-2H-pyridine-1-carboxylate