CAS 96516-32-4

2-Chloro-3-fluorobenzenemethanol

Description:

2-Chloro-3-fluorobenzenemethanol, with the CAS number 96516-32-4, is an organic compound characterized by the presence of a benzene ring substituted with both a chlorine and a fluorine atom, as well as a hydroxymethyl group (-CH2OH). This compound typically exhibits a polar nature due to the hydroxymethyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The presence of halogen substituents (chlorine and fluorine) can significantly affect its reactivity and stability, often making it more reactive in nucleophilic substitution reactions. The compound may also display interesting properties such as varying boiling and melting points, depending on the specific molecular interactions and the arrangement of substituents. Additionally, the presence of both chlorine and fluorine can impart unique electronic properties, potentially making it useful in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₆ClFO

InChI: InChI=1S/C7H6ClFO/c8-7-5(4-10)2-1-3-6(7)9/h1-3,10H,4H2

InChI key: InChIKey=KHRLIQXQMVPXSB-UHFFFAOYSA-N

SMILES: C(O)C1=C(Cl)C(F)=CC=C1

Synonyms:

• (2-Chloro-3-fluorophenyl)methanol
• 2-Chloro-3-fluorobenzenemethanol
• Benzenemethanol, 2-chloro-3-fluoro-

(2-Chloro-3-fluorophenyl)methanol

CAS: 96516-32-4

Formula: C₇H₆ClFO

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.5733

Ref: IN-DA005TVO

2-Chloro-3-fluorobenzyl alcohol

CAS: 96516-32-4

2-Chloro-3-fluorobenzyl alcohol

Purity: 97%

Molecular weight: 160.57g/mol

Ref: 54-PC500402

2-Chloro-3-fluorobenzyl alcohol

CAS: 96516-32-4

2-Chloro-3-fluorobenzyl alcohol is a versatile building block for the synthesis of complex compounds. It has been used as a reagent and intermediate in research chemical synthesis. This compound is useful for the preparation of high quality, useful intermediates and reaction components. 2-Chloro-3-fluorobenzyl alcohol can be used as a scaffold to build different organic compounds with different functional groups.

Formula: C₇H₆ClFO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 160.57 g/mol

Ref: 3D-FC66736

2-Chloro-3-fluorobenzyl alcohol

CAS: 96516-32-4

Formula: C₇H₆ClFO

Purity: 97%+(GC-MS);RG

Molecular weight: 160.57

Ref: 10-F093928