CymitQuimica logo

CAS 96517-97-4

:

6,6′-Bis(bromomethyl)-2,2′-bipyridine

Description:
6,6′-Bis(bromomethyl)-2,2′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of bromomethyl groups at the 6 and 6' positions enhances its reactivity, making it useful in various chemical applications, including coordination chemistry and organic synthesis. This compound typically exhibits a crystalline solid form and is soluble in organic solvents. Its bromine substituents can participate in nucleophilic substitution reactions, allowing for further functionalization. Additionally, the bipyridine moiety can coordinate with metal ions, making it valuable in the development of metal-organic frameworks and catalysts. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other reagents. Safety precautions should be taken when handling this substance, as it may pose health risks due to the presence of bromine, which is toxic and can cause irritation.
Formula:C12H10Br2N2
InChI:InChI=1S/C12H10Br2N2/c13-7-9-3-1-5-11(15-9)12-6-2-4-10(8-14)16-12/h1-6H,7-8H2
InChI key:InChIKey=NFQNNYSVIFMWGU-UHFFFAOYSA-N
SMILES:C(Br)C1=NC(=CC=C1)C=2N=C(CBr)C=CC2
Synonyms:
  • 2,2′-Bipyridine, 6,6′-bis(bromomethyl)-
  • 6,6′-Di(bromomethyl)-2,2′-bipyridine
  • 6,6′-Bis(bromomethyl)-2,2′-bipyridine
  • 2-(Bromomethyl)-6-[6-(bromomethyl)pyridin-2-yl]pyridine
  • 6,6′-Bis(bromomethyl)-2,2′-bipyridyl
Found 6 products.