CAS 96520-39-7

4-butyl-5-methylisoxazol-3(2H)-one

Description:

4-butyl-5-methylisoxazol-3(2H)-one, with the CAS number 96520-39-7, is a heterocyclic organic compound characterized by its isoxazole ring structure, which consists of a five-membered ring containing both nitrogen and oxygen atoms. This compound features a butyl group and a methyl group, contributing to its hydrophobic characteristics and influencing its solubility in organic solvents. Typically, isoxazole derivatives exhibit a range of biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in pharmaceutical research. The presence of the butyl and methyl substituents can affect the compound's reactivity and interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the isoxazole ring. Overall, 4-butyl-5-methylisoxazol-3(2H)-one represents a class of compounds that may have potential applications in medicinal chemistry and material science.

Formula: C₈H₁₃NO₂

InChI: InChI=1/C8H13NO2/c1-3-4-5-7-6(2)11-9-8(7)10/h3-5H2,1-2H3,(H,9,10)

4-Butyl-5-methyl-1,2-oxazol-3-ol

CAS: 96520-39-7

4-Butyl-5-methyl-1,2-oxazol-3-ol

Purity: 95%

Molecular weight: 155.19g/mol

Ref: 54-OR32912