CAS 96530-75-5

4-fluoropyridin-2(1H)-one

Description:

4-Fluoropyridin-2(1H)-one, with the CAS number 96530-75-5, is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom and a ketone functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure includes a nitrogen atom in the pyridine ring, which contributes to its basicity and potential reactivity in various chemical reactions. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 4-fluoropyridin-2(1H)-one may participate in nucleophilic substitution reactions and can serve as a building block for synthesizing more complex molecules. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, this compound is valuable in research and industrial applications, particularly in the synthesis of pharmaceuticals and agrochemicals.

Formula: C₅H₄FNO

InChI: InChI=1/C5H4FNO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8)

SMILES: c1cnc(cc1F)O

Synonyms:

• 2-Pyridinol, 4-Fluoro-
• 4-Fluoro-2(1H)-pyridinone
• 4-Fluoropyridin-2-ol
• 2-Hydroxy-4-Fluoropyridine
• 4-Fluoro-2-Hydroxypyridine

4-Fluoropyridin-2(1H)-one

CAS: 96530-75-5

Formula: C₅H₄FNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 113.0898

Ref: IN-DA005TVF

4-Fluoropyridin-2(1H)-one

CAS: 96530-75-5

4-Fluoropyridin-2(1H)-one

Formula: C₅H₄FNO

Purity: 97%

Color and Shape: white to off-white solid

Molecular weight: 113.09g/mol

Ref: 54-PC201387

4-Fluoropyridin-2-ol

CAS: 96530-75-5

Formula: C₅H₄FNO

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 113.091

Ref: 10-F077312