CAS 96539-87-6

H-.beta.-Cyclopentyl-DL-Ala-OH

Description:

H-β-Cyclopentyl-DL-Ala-OH, with the CAS number 96539-87-6, is a chemical compound that belongs to the class of amino acids, specifically a derivative of alanine. It features a cyclopentyl group attached to the β-carbon of the alanine structure, which contributes to its unique properties. This compound is characterized by its potential biological activity, often studied in the context of peptide synthesis and medicinal chemistry. The presence of the cyclopentyl group may influence its hydrophobicity and steric properties, affecting its interactions with biological targets. As an amino acid derivative, it can participate in various chemical reactions, including peptide bond formation, making it relevant in the synthesis of peptides and proteins. Additionally, its structural features may allow for specific conformational arrangements, which can be crucial for its function in biological systems. Overall, H-β-Cyclopentyl-DL-Ala-OH is of interest in both synthetic organic chemistry and pharmacological research due to its potential applications.

Formula: C₈H₁₅NO₂

InChI: InChI=1/C8H15NO2/c9-7(8(10)11)5-6-3-1-2-4-6/h6-7H,1-5,9H2,(H,10,11)

SMILES: C1CCC(C1)CC(C(=O)O)N

Synonyms:

• 3-Cyclopentyl-DL-alanine
• 3-Cyclopentylalanine

3-DL-Cpa-OH

CAS: 96539-87-6

Formula: C₈H₁₅NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 157.2102

Ref: IN-DA003JCU

3-Cyclopentyl-DL-alanine

CAS: 96539-87-6

Formula: C₈H₁₅NO₂

Purity: ≥ 97.0%

Color and Shape: White to off-white powder

Molecular weight: 157.21

Ref: 7W-GM6221

3-Cyclopentylalanine

CAS: 96539-87-6

3-Cyclopentylalanine

Purity: 98%

Color and Shape: Beige Solid

Molecular weight: 157.21g/mol

Ref: 54-OR451213

2-Amino-3-cyclopentylpropanoic acid

CAS: 96539-87-6

Formula: C₈H₁₅NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 157.213

Ref: 10-F243189

-β-Cyclopentyl-DL-alanine

CAS: 96539-87-6

-beta-Cyclopentyl-DL-alanine is a potent antagonist of the alpha-1A adrenergic receptor. It has been shown to inhibit the proliferation of prostate cancer cells and t47d cells in an experimental model. -beta-Cyclopentyl-DL-alanine also possesses antiangiogenic properties and inhibits bone cancer growth. This compound has chemical stability, which makes it suitable for use in biological studies or as a pharmaceutical agent.

Formula: C₈H₁₅NO₂

Purity: Min. 95%

Molecular weight: 157.21 g/mol

Ref: 3D-FC48797