CAS 96543-07-6

ethyl 5-sulfamoyl-1H-pyrazole-4-carboxylate

Description:

Ethyl 5-sulfamoyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a sulfonamide group and a carboxylate moiety. This compound typically exhibits properties associated with both sulfonamides and pyrazole derivatives, such as potential biological activity, including antimicrobial and anti-inflammatory effects. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry. The sulfonamide functional group is known for its ability to form hydrogen bonds, which can influence the compound's reactivity and interaction with biological targets. Additionally, the carboxylate group may participate in ionic interactions, further affecting its pharmacological profile. Overall, ethyl 5-sulfamoyl-1H-pyrazole-4-carboxylate represents a class of compounds that may be explored for therapeutic applications, particularly in the development of new drugs targeting specific diseases.

Formula: C₆H₉N₃O₄S

InChI: InChI=1/C6H9N3O4S/c1-2-13-6(10)4-3-8-9-5(4)14(7,11)12/h3H,2H2,1H3,(H,8,9)(H2,7,11,12)

SMILES: CCOC(=O)c1c[nH]nc1S(=O)(=O)N

Synonyms:

• ethyl 5-(aminosulfonyl)-1H-pyrazole-4-carboxylate

Ethyl 5-sulfamoyl-1H-pyrazole-4-carboxylate

CAS: 96543-07-6

Versatile small molecule scaffold

Formula: C₆H₉N₃O₄S

Purity: Min. 95%

Molecular weight: 219.22 g/mol

Ref: 3D-WDA54307