CymitQuimica logo

CAS 96553-02-5

:

gypsogenin-3-O-glucuronide

Description:
Gypsogenin-3-O-glucuronide is a chemical compound classified as a glycoside, specifically a glucuronide derivative of gypsogenin, which is a natural steroid sapogenin. This compound is characterized by the presence of a glucuronic acid moiety attached to the gypsogenin structure, which enhances its solubility and bioavailability. Gypsogenin itself is derived from various plant sources, particularly those in the Dioscorea genus, and is known for its potential pharmacological properties. The glucuronidation process typically serves to facilitate the excretion of compounds from the body, making gypsogenin-3-O-glucuronide potentially relevant in metabolic studies. In terms of its physical properties, gypsogenin-3-O-glucuronide is expected to be a white to off-white solid, soluble in polar solvents due to the glucuronic acid component. Its biological activities may include anti-inflammatory and antioxidant effects, although specific studies on gypsogenin-3-O-glucuronide are limited. Overall, this compound represents an interesting area of research in natural product chemistry and pharmacology.
Formula:C37H56O10
InChI:InChI=1S/C37H56O10/c1-32(2)14-16-37(31(43)44)17-15-35(5)20(21(37)18-32)8-9-23-33(3)12-11-24(34(4,19-38)22(33)10-13-36(23,35)6)46-30-27(41)25(39)26(40)28(47-30)29(42)45-7/h8,19,21-28,30,39-41H,9-18H2,1-7H3,(H,43,44)/t21-,22+,23+,24-,25-,26-,27+,28-,30+,33-,34-,35+,36+,37-/m0/s1
InChI key:LHZZULHOQSQSJN-UPGAAKEKSA-N
SMILES:C[C@]12CC[C@@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)OC)O)O)O
Synonyms:
  • (3beta,4alpha)-17-Carboxy-23-oxo-28-norolean-12-en-3-yl-beta-D-glucopyranosiduronic acid 6-methyl este
  • methyl(gypsogenin-3-O-β-D-glucopyranoside)uronate
Found 9 products.