CAS 96555-37-2
:6-amino-3-bromo-1-(beta-D-ribofuranosyl)-1,2-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
Description:
6-amino-3-bromo-1-(beta-D-ribofuranosyl)-1,2-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is a heterocyclic compound characterized by its pyrazolo-pyrimidine core structure, which incorporates both amino and bromo substituents. The presence of the ribofuranosyl group indicates that this compound is a nucleoside analog, potentially influencing its biological activity, particularly in relation to nucleic acid metabolism. The amino group typically enhances solubility and can participate in hydrogen bonding, while the bromo substituent may affect the compound's reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential antiviral or anticancer properties, as many nucleoside analogs are designed to interfere with viral replication or cancer cell proliferation. Its specific structural features contribute to its pharmacological profile, making it a subject of research in drug development. As with many such compounds, understanding its stability, solubility, and interaction with biological systems is crucial for evaluating its therapeutic potential.
Formula:C10H12BrN5O5
InChI:InChI=1/C10H12BrN5O5/c11-6-3-7(13-10(12)14-8(3)20)16(15-6)9-5(19)4(18)2(1-17)21-9/h2,4-5,9,15,17-19H,1H2,(H2,12,14,20)/t2-,4-,5-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2c3c(c(Br)[nH]2)c(nc(=N)n3)O)O1)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Aza-7-bromo-7-deazaguanosine
CAS:8-Aza-7-bromo-7-deazaguanosine is a Nucleoside Derivative - 7-Deaza-8-aza-purine nucleoside; Halo-nucleoside; Scaffold and Template.Formula:C10H12BrN5O5Color and Shape:SolidMolecular weight:362.14Ref: TM-TNU0275
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
