CAS 96558-24-6

6-[4-(3-Dimethylamino-2-hydroxypropoxy)phenyl]-2,4,7-pteridinetriamine

Description:

6-[4-(3-Dimethylamino-2-hydroxypropoxy)phenyl]-2,4,7-pteridinetriamine, with the CAS number 96558-24-6, is a chemical compound that belongs to the class of pteridine derivatives. This substance is characterized by its complex structure, which includes a pteridine ring system fused with an amino group and a phenyl moiety substituted with a dimethylamino and hydroxypropoxy group. The presence of the dimethylamino group suggests potential basicity and the ability to form hydrogen bonds, which may influence its solubility and reactivity. The hydroxypropoxy group can enhance the compound's hydrophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, the unique structural features of this compound contribute to its potential applications in various fields, including drug development and biochemical research.

Formula: C₁₇H₂₂N₈O₂

InChI: InChI=1/C17H22N8O2/c1-25(2)7-10(26)8-27-11-5-3-9(4-6-11)12-14(18)22-16-13(21-12)15(19)23-17(20)24-16/h3-6,10,26H,7-8H2,1-2H3,(H6,18,19,20,22,23,24)

SMILES: CN(C)CC(COc1ccc(cc1)c1c(=N)nc2c(c(N)[nH]c(=N)[nH]2)n1)O

Synonyms:

• Rph-2823
• 1-(Dimethylamino)-3-[4-(2,4,7-Triaminopteridin-6-Yl)Phenoxy]Propan-2-Ol

RPH-2823

CAS: 96558-24-6

RPH-2823

Purity: ≥98%

Molecular weight: 370.41g/mol

Ref: 54-BUP21603

RPH-2823

CAS: 96558-24-6

RPH-2823 is a cutting-edge biochemical reagent, meticulously synthesized through advanced organic chemistry processes. This compound is derived from a series of complex reactions involving proprietary modifications to enhance its stability and reactivity under physiological conditions. The intricate mode of action of RPH-2823 involves targeting specific biochemical pathways, allowing for precise interaction at the molecular level with target receptors or enzymes. It exhibits strong affinity and selectivity, making it a valuable tool in modulating biological activities. RPH-2823 finds extensive applications in biochemical research, particularly within cellular signaling and metabolic pathway studies. It serves as an indispensable resource for unraveling complex biological mechanisms, facilitating the identification and characterization of potential therapeutic targets. Scientists utilize RPH-2823 to gain insights into cellular processes, offering the potential for groundbreaking discoveries in pharmacology and biotechnology.

Formula: C₁₇H₂₂N₈O₂

Purity: Min. 95%

Molecular weight: 370.41 g/mol

Ref: 3D-WDA55824

RPH-2823

CAS: 96558-24-6

RPH-2823, a basic amphotericin analog, is diuretic, natriuretic, and potassium-preserving, inducing a dose-dependent decrease in SCC and an increase in trans-

Formula: C₁₇H₂₂N₈O₂

Purity: 99.67%

Color and Shape: Solid

Molecular weight: 370.41

Ref: TM-T19552